C10H14N4 — CID 105444436
3,5-dimethyl-1-pyrrolidin-3-ylpyrazole-4-carbonitrile (PubChem CID 105444436) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 3,5-dimethyl-1-pyrrolidin-3-ylpyrazole-4-carbonitrile.
| Compound Name | 3,5-dimethyl-1-pyrrolidin-3-ylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 105444436 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 3,5-dimethyl-1-pyrrolidin-3-ylpyrazole-4-carbonitrile |
| SMILES | Cc1nn(C2CCNC2)c(C)c1C#N |
| InChI | InChI=1S/C10H14N4/c1-7-10(5-11)8(2)14(13-7)9-3-4-12-6-9/h9,12H,3-4,6H2,1-2H3 |
| InChIKey | ZJYYCSFOULSKMV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |