C23H41N — CID 10544512
1-[(1S,3aR,6aR)-2-cyclopentyl-1-pentyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]piperidine (PubChem CID 10544512) has the molecular formula C23H41N and a molecular weight of 331.59 g/mol. Its IUPAC name is 1-[(1S,3aR,6aR)-2-cyclopentyl-1-pentyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]piperidine.
| Compound Name | 1-[(1S,3aR,6aR)-2-cyclopentyl-1-pentyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]piperidine |
|---|---|
| PubChem CID | 10544512 |
| Molecular Formula | C23H41N |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.32 |
| IUPAC Name | 1-[(1S,3aR,6aR)-2-cyclopentyl-1-pentyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]piperidine |
| SMILES | CCCCC[C@H]1[C@@H]2CCC[C@@H]2CC1(C1CCCC1)N1CCCCC1 |
| InChI | InChI=1S/C23H41N/c1-2-3-5-15-22-21-14-10-11-19(21)18-23(22,20-12-6-7-13-20)24-16-8-4-9-17-24/h19-22H,2-18H2,1H3/t19-,21-,22+,23?/m1/s1 |
| InChIKey | LNSADYGNZASBQG-MEMABINQSA-N |
| XLogP | 6.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|