C16H16ClN3OS — CID 10544659
3-[4-chloro-2-(phenylcarbamothioyl)phenyl]-1,1-dimethylurea (PubChem CID 10544659) has the molecular formula C16H16ClN3OS and a molecular weight of 333.84 g/mol. Its IUPAC name is 3-[4-chloro-2-(phenylcarbamothioyl)phenyl]-1,1-dimethylurea.
| Compound Name | 3-[4-chloro-2-(phenylcarbamothioyl)phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 10544659 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-[4-chloro-2-(phenylcarbamothioyl)phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(Cl)cc1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C16H16ClN3OS/c1-20(2)16(21)19-14-9-8-11(17)10-13(14)15(22)18-12-6-4-3-5-7-12/h3-10H,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | UVUYUXSQNYQARL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|