C21H21NO3 — CID 10544774
(4R,5S)-3-[(1R,2R)-2-(hydroxymethyl)-3-methylidenecyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 10544774) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (4R,5S)-3-[(1R,2R)-2-(hydroxymethyl)-3-methylidenecyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(1R,2R)-2-(hydroxymethyl)-3-methylidenecyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10544774 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (4R,5S)-3-[(1R,2R)-2-(hydroxymethyl)-3-methylidenecyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | C=C1C[C@@H](N2C(=O)O[C@@H](c3ccccc3)[C@H]2c2ccccc2)[C@@H]1CO |
| InChI | InChI=1S/C21H21NO3/c1-14-12-18(17(14)13-23)22-19(15-8-4-2-5-9-15)20(25-21(22)24)16-10-6-3-7-11-16/h2-11,17-20,23H,1,12-13H2/t17-,18-,19-,20+/m1/s1 |
| InChIKey | SFYHBSKYHMJILF-WTGUMLROSA-N |
| XLogP | 3.86 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|