C10H14N2S — CID 105448612
2-(azetidin-3-ylmethyl)-4-cyclopropyl-1,3-thiazole (PubChem CID 105448612) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-(azetidin-3-ylmethyl)-4-cyclopropyl-1,3-thiazole.
| Compound Name | 2-(azetidin-3-ylmethyl)-4-cyclopropyl-1,3-thiazole |
|---|---|
| PubChem CID | 105448612 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(azetidin-3-ylmethyl)-4-cyclopropyl-1,3-thiazole |
| SMILES | c1sc(CC2CNC2)nc1C1CC1 |
| InChI | InChI=1S/C10H14N2S/c1-2-8(1)9-6-13-10(12-9)3-7-4-11-5-7/h6-8,11H,1-5H2 |
| InChIKey | HBDXNKBJPHDAME-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |