About 5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid
5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid (PubChem CID 105448866) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid.
Analyze 5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid?
The IUPAC name of 5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid (CID 105448866) is 5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid.
What is the SMILES notation for 5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid?
The canonical SMILES for 5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid is Cn1nc(C(=O)O)c2c1CCC(N)C2.
What is the InChIKey of 5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid?
The InChIKey is FUJAPEPQHWGJKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-12-7-3-2-5(10)4-6(7)8(11-12)9(13)14/h5H,2-4,10H2,1H3,(H,13,14).
What are the key properties of 5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid?
5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid has a molecular weight of 195.22 g/mol, XLogP of -0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid is sourced from PubChem (CID 105448866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).