About ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate
ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate (PubChem CID 83854760) has the molecular formula C11H17N3O2
and a molecular weight of 223.28 g/mol. Its IUPAC name is ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate.
Analyze ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate?
The IUPAC name of ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate (CID 83854760) is ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate.
What is the SMILES notation for ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate?
The canonical SMILES for ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate is CCOC(=O)c1nn(C)c2c1CCC(N)C2.
What is the InChIKey of ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate?
The InChIKey is HRSZIUCOUSEUJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2/c1-3-16-11(15)10-8-5-4-7(12)6-9(8)14(2)13-10/h7H,3-6,12H2,1-2H3.
What are the key properties of ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate?
ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate has a molecular weight of 223.28 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-amino-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylate is sourced from PubChem (CID 83854760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).