C11H14FNO — CID 105449024
2-(6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl)ethanol (PubChem CID 105449024) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-(6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl)ethanol.
| Compound Name | 2-(6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl)ethanol |
|---|---|
| PubChem CID | 105449024 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 2-(6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl)ethanol |
| SMILES | OCCC1NCCc2cc(F)ccc21 |
| InChI | InChI=1S/C11H14FNO/c12-9-1-2-10-8(7-9)3-5-13-11(10)4-6-14/h1-2,7,11,13-14H,3-6H2 |
| InChIKey | ZVTNYPSVEKQOAB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |