C20H18O5 — CID 10544971
2-(1-hydroxyhexyl)anthracene-1,4,9,10-tetrone (PubChem CID 10544971) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-(1-hydroxyhexyl)anthracene-1,4,9,10-tetrone.
| Compound Name | 2-(1-hydroxyhexyl)anthracene-1,4,9,10-tetrone |
|---|---|
| PubChem CID | 10544971 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-(1-hydroxyhexyl)anthracene-1,4,9,10-tetrone |
| SMILES | CCCCCC(O)c1cc(=O)c2c(=O)c3ccccc3c(=O)c=2c1=O |
| InChI | InChI=1S/C20H18O5/c1-2-3-4-9-14(21)13-10-15(22)16-17(20(13)25)19(24)12-8-6-5-7-11(12)18(16)23/h5-8,10,14,21H,2-4,9H2,1H3 |
| InChIKey | RGGQVKBPPCNZAR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|