C13H16O3 — CID 170619933
2-hydroxy-5-(1-hydroxyhexyl)bicyclo[4.1.0]hepta-1,3,5-trien-7-one (PubChem CID 170619933) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-hydroxy-5-(1-hydroxyhexyl)bicyclo[4.1.0]hepta-1,3,5-trien-7-one.
| Compound Name | 2-hydroxy-5-(1-hydroxyhexyl)bicyclo[4.1.0]hepta-1,3,5-trien-7-one |
|---|---|
| PubChem CID | 170619933 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-hydroxy-5-(1-hydroxyhexyl)bicyclo[4.1.0]hepta-1,3,5-trien-7-one |
| SMILES | CCCCCC(O)c1ccc(O)c2c(=O)c12 |
| InChI | InChI=1S/C13H16O3/c1-2-3-4-5-9(14)8-6-7-10(15)12-11(8)13(12)16/h6-7,9,14-15H,2-5H2,1H3 |
| InChIKey | BNGFTXGNUWRUJU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|