C11H19NO2 — CID 105450803
4-cyclohexyl-4-methyl-1,3-oxazinan-2-one (PubChem CID 105450803) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-cyclohexyl-4-methyl-1,3-oxazinan-2-one.
| Compound Name | 4-cyclohexyl-4-methyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 105450803 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 4-cyclohexyl-4-methyl-1,3-oxazinan-2-one |
| SMILES | CC1(C2CCCCC2)CCOC(=O)N1 |
| InChI | InChI=1S/C11H19NO2/c1-11(7-8-14-10(13)12-11)9-5-3-2-4-6-9/h9H,2-8H2,1H3,(H,12,13) |
| InChIKey | NEUBSPATJHUGQI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |