5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid

C9H11FN2O2 — CID 105451338

IUPAC5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid
SMILESCn1nc(C(=O)O)c2c1CCC(F)C2
InChIInChI=1S/C9H11FN2O2/c1-12-7-3-2-5(10)4-6(7)8(11-12)9(13)14/h5H,2-4H2,1H3,(H,13,14)
InChIKeyLUHMZJRWJOGCJW-UHFFFAOYSA-N
MW198.20 g/mol
LogP0.95
Rot. Bonds1

About 5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid

5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid (PubChem CID 105451338) has the molecular formula C9H11FN2O2 and a molecular weight of 198.20 g/mol. Its IUPAC name is 5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid.

Molecular Properties

Compound Name5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid
PubChem CID105451338
Molecular FormulaC9H11FN2O2
Molecular Weight198.20 g/mol
Exact Mass198.08
IUPAC Name5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid
SMILESCn1nc(C(=O)O)c2c1CCC(F)C2
InChIInChI=1S/C9H11FN2O2/c1-12-7-3-2-5(10)4-6(7)8(11-12)9(13)14/h5H,2-4H2,1H3,(H,13,14)
InChIKeyLUHMZJRWJOGCJW-UHFFFAOYSA-N
XLogP0.95
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.20
LogP ≤ 50.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid?
The IUPAC name of 5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid (CID 105451338) is 5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid.
What is the SMILES notation for 5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid?
The canonical SMILES for 5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid is Cn1nc(C(=O)O)c2c1CCC(F)C2.
What is the InChIKey of 5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid?
The InChIKey is LUHMZJRWJOGCJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O2/c1-12-7-3-2-5(10)4-6(7)8(11-12)9(13)14/h5H,2-4H2,1H3,(H,13,14).
What are the key properties of 5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid?
5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid has a molecular weight of 198.20 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid is sourced from PubChem (CID 105451338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).