About 3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile
3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile (PubChem CID 105452012) has the molecular formula C10H9N5
and a molecular weight of 199.22 g/mol. Its IUPAC name is 3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile.
Analyze 3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile?
The IUPAC name of 3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile (CID 105452012) is 3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile.
What is the SMILES notation for 3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile?
The canonical SMILES for 3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile is N#Cc1cnc2c(C3CCC3)nnn2c1.
What is the InChIKey of 3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile?
The InChIKey is GBVROGFIQPYNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5/c11-4-7-5-12-10-9(8-2-1-3-8)13-14-15(10)6-7/h5-6,8H,1-3H2.
What are the key properties of 3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile?
3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile has a molecular weight of 199.22 g/mol, XLogP of 1.26, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutyltriazolo[1,5-a]pyrimidine-6-carbonitrile is sourced from PubChem (CID 105452012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).