C13H14N4 — CID 82271954
2-cyclohexylpyrazolo[1,5-a]pyrimidine-3-carbonitrile (PubChem CID 82271954) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-cyclohexylpyrazolo[1,5-a]pyrimidine-3-carbonitrile.
| Compound Name | 2-cyclohexylpyrazolo[1,5-a]pyrimidine-3-carbonitrile |
|---|---|
| PubChem CID | 82271954 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-cyclohexylpyrazolo[1,5-a]pyrimidine-3-carbonitrile |
| SMILES | N#Cc1c(C2CCCCC2)nn2cccnc12 |
| InChI | InChI=1S/C13H14N4/c14-9-11-12(10-5-2-1-3-6-10)16-17-8-4-7-15-13(11)17/h4,7-8,10H,1-3,5-6H2 |
| InChIKey | DFUAGZKKYURMBM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |