C12H13N3 — CID 105452207
3-(aminomethyl)-1,2-dimethylindole-6-carbonitrile (PubChem CID 105452207) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 3-(aminomethyl)-1,2-dimethylindole-6-carbonitrile.
| Compound Name | 3-(aminomethyl)-1,2-dimethylindole-6-carbonitrile |
|---|---|
| PubChem CID | 105452207 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 3-(aminomethyl)-1,2-dimethylindole-6-carbonitrile |
| SMILES | Cc1c(CN)c2ccc(C#N)cc2n1C |
| InChI | InChI=1S/C12H13N3/c1-8-11(7-14)10-4-3-9(6-13)5-12(10)15(8)2/h3-5H,7,14H2,1-2H3 |
| InChIKey | PYYHHWWANCSSDJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|