About 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine
2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 105452506) has the molecular formula C6H2ClN3O3
and a molecular weight of 199.55 g/mol. Its IUPAC name is 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine |
| PubChem CID | 105452506 |
| Molecular Formula | C6H2ClN3O3 |
| Molecular Weight | 199.55 g/mol |
| Exact Mass | 198.98 |
| IUPAC Name | 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | O=[N+]([O-])c1cnc2nc(Cl)oc2c1 |
| InChI | InChI=1S/C6H2ClN3O3/c7-6-9-5-4(13-6)1-3(2-8-5)10(11)12/h1-2H |
| InChIKey | GKLZTNJBEJCPAD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine?
The IUPAC name of 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine (CID 105452506) is 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine.
What is the SMILES notation for 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine?
The canonical SMILES for 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine is O=[N+]([O-])c1cnc2nc(Cl)oc2c1.
What is the InChIKey of 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine?
The InChIKey is GKLZTNJBEJCPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2ClN3O3/c7-6-9-5-4(13-6)1-3(2-8-5)10(11)12/h1-2H.
What are the key properties of 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine?
2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine has a molecular weight of 199.55 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine is sourced from PubChem (CID 105452506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).