C6H2ClN3O3 — CID 105452506
2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 105452506) has the molecular formula C6H2ClN3O3 and a molecular weight of 199.55 g/mol. Its IUPAC name is 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 105452506 |
| Molecular Formula | C6H2ClN3O3 |
| Molecular Weight | 199.55 g/mol |
| Exact Mass | 198.98 |
| IUPAC Name | 2-chloro-6-nitro-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | O=[N+]([O-])c1cnc2nc(Cl)oc2c1 |
| InChI | InChI=1S/C6H2ClN3O3/c7-6-9-5-4(13-6)1-3(2-8-5)10(11)12/h1-2H |
| InChIKey | GKLZTNJBEJCPAD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|