C17H2Cl10N2O2 — CID 134617551
5-nitro-2,3-bis(2,3,4,5,6-pentachlorophenyl)pyridine (PubChem CID 134617551) has the molecular formula C17H2Cl10N2O2 and a molecular weight of 620.75 g/mol. Its IUPAC name is 5-nitro-2,3-bis(2,3,4,5,6-pentachlorophenyl)pyridine.
| Compound Name | 5-nitro-2,3-bis(2,3,4,5,6-pentachlorophenyl)pyridine |
|---|---|
| PubChem CID | 134617551 |
| Molecular Formula | C17H2Cl10N2O2 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 615.70 |
| IUPAC Name | 5-nitro-2,3-bis(2,3,4,5,6-pentachlorophenyl)pyridine |
| SMILES | O=[N+]([O-])c1cnc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H2Cl10N2O2/c18-7-5(8(19)12(23)15(26)11(7)22)4-1-3(29(30)31)2-28-17(4)6-9(20)13(24)16(27)14(25)10(6)21/h1-2H |
| InChIKey | ICWIEANQMUNFKW-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|