C8H9ClN2O4 — CID 156566047
2-(3-chloro-5-nitro-2-pyridinyl)propane-1,3-diol (PubChem CID 156566047) has the molecular formula C8H9ClN2O4 and a molecular weight of 232.62 g/mol. Its IUPAC name is 2-(3-chloro-5-nitro-2-pyridinyl)propane-1,3-diol.
| Compound Name | 2-(3-chloro-5-nitro-2-pyridinyl)propane-1,3-diol |
|---|---|
| PubChem CID | 156566047 |
| Molecular Formula | C8H9ClN2O4 |
| Molecular Weight | 232.62 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2-(3-chloro-5-nitro-2-pyridinyl)propane-1,3-diol |
| SMILES | O=[N+]([O-])c1cnc(C(CO)CO)c(Cl)c1 |
| InChI | InChI=1S/C8H9ClN2O4/c9-7-1-6(11(14)15)2-10-8(7)5(3-12)4-13/h1-2,5,12-13H,3-4H2 |
| InChIKey | GHFYRQZCRMXURT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.62 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|