C7H8N2O3S — CID 105452702
2-methyl-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazole-3-carbaldehyde (PubChem CID 105452702) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is 2-methyl-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazole-3-carbaldehyde.
| Compound Name | 2-methyl-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 105452702 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 2-methyl-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazole-3-carbaldehyde |
| SMILES | Cn1nc2c(c1C=O)CS(=O)(=O)C2 |
| InChI | InChI=1S/C7H8N2O3S/c1-9-7(2-10)5-3-13(11,12)4-6(5)8-9/h2H,3-4H2,1H3 |
| InChIKey | SJMGCDAFRPQXFM-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|