About 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine
2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 105453277) has the molecular formula C7H9BrN2
and a molecular weight of 201.07 g/mol. Its IUPAC name is 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
Analyze 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
The IUPAC name of 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (CID 105453277) is 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
What is the SMILES notation for 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
The canonical SMILES for 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine is Brc1cc2n(n1)CCCC2.
What is the InChIKey of 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
The InChIKey is DYHPPHVXHUUVFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2/c8-7-5-6-3-1-2-4-10(6)9-7/h5H,1-4H2.
What are the key properties of 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine has a molecular weight of 201.07 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine is sourced from PubChem (CID 105453277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).