C9H15NO2S — CID 105453849
methyl 2,3,4,5,7,7a-hexahydro-1H-thiopyrano[3,4-b]pyrrole-3a-carboxylate (PubChem CID 105453849) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is methyl 2,3,4,5,7,7a-hexahydro-1H-thiopyrano[3,4-b]pyrrole-3a-carboxylate.
| Compound Name | methyl 2,3,4,5,7,7a-hexahydro-1H-thiopyrano[3,4-b]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 105453849 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | methyl 2,3,4,5,7,7a-hexahydro-1H-thiopyrano[3,4-b]pyrrole-3a-carboxylate |
| SMILES | COC(=O)C12CCNC1CSCC2 |
| InChI | InChI=1S/C9H15NO2S/c1-12-8(11)9-2-4-10-7(9)6-13-5-3-9/h7,10H,2-6H2,1H3 |
| InChIKey | VSIZRKUCDMSUOU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |