C6H9NO2 — CID 98111876
(1R,5S)-2-azabicyclo[3.1.0]hexane-5-carboxylic acid (PubChem CID 98111876) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is (1R,5S)-2-azabicyclo[3.1.0]hexane-5-carboxylic acid.
| Compound Name | (1R,5S)-2-azabicyclo[3.1.0]hexane-5-carboxylic acid |
|---|---|
| PubChem CID | 98111876 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (1R,5S)-2-azabicyclo[3.1.0]hexane-5-carboxylic acid |
| SMILES | O=C(O)[C@]12CCN[C@@H]1C2 |
| InChI | InChI=1S/C6H9NO2/c8-5(9)6-1-2-7-4(6)3-6/h4,7H,1-3H2,(H,8,9)/t4-,6+/m1/s1 |
| InChIKey | JYHVSRGEHWDOCH-XINAWCOVSA-N |
| XLogP | -0.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |