C8H8Cl2N2 — CID 105454954
2,5-dichloro-6-cyclopropylpyridin-3-amine (PubChem CID 105454954) has the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. Its IUPAC name is 2,5-dichloro-6-cyclopropylpyridin-3-amine.
| Compound Name | 2,5-dichloro-6-cyclopropylpyridin-3-amine |
|---|---|
| PubChem CID | 105454954 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 2,5-dichloro-6-cyclopropylpyridin-3-amine |
| SMILES | Nc1cc(Cl)c(C2CC2)nc1Cl |
| InChI | InChI=1S/C8H8Cl2N2/c9-5-3-6(11)8(10)12-7(5)4-1-2-4/h3-4H,1-2,11H2 |
| InChIKey | FZAHIGSOAAIFKB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|