About [1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine
[1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine (PubChem CID 105454986) has the molecular formula C5H8F3NO2S
and a molecular weight of 203.18 g/mol. Its IUPAC name is [1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine.
Analyze [1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine?
The IUPAC name of [1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine (CID 105454986) is [1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine.
What is the SMILES notation for [1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine?
The canonical SMILES for [1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine is NCC1(C(F)(F)F)CS(=O)(=O)C1.
What is the InChIKey of [1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine?
The InChIKey is CNVIZZONONWWDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F3NO2S/c6-5(7,8)4(1-9)2-12(10,11)3-4/h1-3,9H2.
What are the key properties of [1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine?
[1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine has a molecular weight of 203.18 g/mol, XLogP of -0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-dioxo-3-(trifluoromethyl)thietan-3-yl]methanamine is sourced from PubChem (CID 105454986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).