C9H17NO2S — CID 105455803
2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-2-methylpropan-1-amine (PubChem CID 105455803) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is 2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-2-methylpropan-1-amine.
| Compound Name | 2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 105455803 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-2-methylpropan-1-amine |
| SMILES | CC(C)(CN)C1=CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H17NO2S/c1-9(2,7-10)8-3-5-13(11,12)6-4-8/h3H,4-7,10H2,1-2H3 |
| InChIKey | XIKMDAPPOUAKMV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|