C13H25NO2S — CID 106732400
5,5-dimethyl-3-(2-propylsulfonylethyl)cyclohex-2-en-1-amine (PubChem CID 106732400) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is 5,5-dimethyl-3-(2-propylsulfonylethyl)cyclohex-2-en-1-amine.
| Compound Name | 5,5-dimethyl-3-(2-propylsulfonylethyl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 106732400 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 5,5-dimethyl-3-(2-propylsulfonylethyl)cyclohex-2-en-1-amine |
| SMILES | CCCS(=O)(=O)CCC1=CC(N)CC(C)(C)C1 |
| InChI | InChI=1S/C13H25NO2S/c1-4-6-17(15,16)7-5-11-8-12(14)10-13(2,3)9-11/h8,12H,4-7,9-10,14H2,1-3H3 |
| InChIKey | QWWIDKRFLJLSNT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|