C13H25NO2S — CID 164769214
4-tert-butyl-N-(2-methylsulfonylethyl)cyclohex-3-en-1-amine (PubChem CID 164769214) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-methylsulfonylethyl)cyclohex-3-en-1-amine.
| Compound Name | 4-tert-butyl-N-(2-methylsulfonylethyl)cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 164769214 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 4-tert-butyl-N-(2-methylsulfonylethyl)cyclohex-3-en-1-amine |
| SMILES | CC(C)(C)C1=CCC(NCCS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H25NO2S/c1-13(2,3)11-5-7-12(8-6-11)14-9-10-17(4,15)16/h5,12,14H,6-10H2,1-4H3 |
| InChIKey | ZTOWOAJZMVXYHT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|