C9H17NO4S2 — CID 163688946
4-methylsulfonyl-3-(methylsulfonylmethyl)cyclohex-2-en-1-amine (PubChem CID 163688946) has the molecular formula C9H17NO4S2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-methylsulfonyl-3-(methylsulfonylmethyl)cyclohex-2-en-1-amine.
| Compound Name | 4-methylsulfonyl-3-(methylsulfonylmethyl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 163688946 |
| Molecular Formula | C9H17NO4S2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-methylsulfonyl-3-(methylsulfonylmethyl)cyclohex-2-en-1-amine |
| SMILES | CS(=O)(=O)CC1=CC(N)CCC1S(C)(=O)=O |
| InChI | InChI=1S/C9H17NO4S2/c1-15(11,12)6-7-5-8(10)3-4-9(7)16(2,13)14/h5,8-9H,3-4,6,10H2,1-2H3 |
| InChIKey | JRHUSUWOWLGWJT-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|