C10H17NO2S — CID 163949009
5-(propan-2-ylsulfonylmethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 163949009) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 5-(propan-2-ylsulfonylmethyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 5-(propan-2-ylsulfonylmethyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 163949009 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 5-(propan-2-ylsulfonylmethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CC(C)S(=O)(=O)CC1=CC=CC(N)C1 |
| InChI | InChI=1S/C10H17NO2S/c1-8(2)14(12,13)7-9-4-3-5-10(11)6-9/h3-5,8,10H,6-7,11H2,1-2H3 |
| InChIKey | RXQOAYDIAXEPIA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |