C12H23NO2S — CID 21034842
N-[(4E)-4-methylhepta-4,6-dien-3-yl]butane-1-sulfonamide (PubChem CID 21034842) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is N-[(4E)-4-methylhepta-4,6-dien-3-yl]butane-1-sulfonamide.
| Compound Name | N-[(4E)-4-methylhepta-4,6-dien-3-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 21034842 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-[(4E)-4-methylhepta-4,6-dien-3-yl]butane-1-sulfonamide |
| SMILES | C=C/C=C(\C)C(CC)NS(=O)(=O)CCCC |
| InChI | InChI=1S/C12H23NO2S/c1-5-8-10-16(14,15)13-12(7-3)11(4)9-6-2/h6,9,12-13H,2,5,7-8,10H2,1,3-4H3/b11-9+ |
| InChIKey | LCQUYZHOZIPYFJ-PKNBQFBNSA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|