C16H20FNO2S — CID 142953292
(2Z,4Z)-N-[(1R)-1-(4-fluorocyclohepta-1,3,6-trien-1-yl)ethyl]hepta-2,4,6-triene-1-sulfonamide (PubChem CID 142953292) has the molecular formula C16H20FNO2S and a molecular weight of 309.41 g/mol. Its IUPAC name is (2Z,4Z)-N-[(1R)-1-(4-fluorocyclohepta-1,3,6-trien-1-yl)ethyl]hepta-2,4,6-triene-1-sulfonamide.
| Compound Name | (2Z,4Z)-N-[(1R)-1-(4-fluorocyclohepta-1,3,6-trien-1-yl)ethyl]hepta-2,4,6-triene-1-sulfonamide |
|---|---|
| PubChem CID | 142953292 |
| Molecular Formula | C16H20FNO2S |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2Z,4Z)-N-[(1R)-1-(4-fluorocyclohepta-1,3,6-trien-1-yl)ethyl]hepta-2,4,6-triene-1-sulfonamide |
| SMILES | C=C/C=C\C=C/CS(=O)(=O)N[C@H](C)C1=CC=C(F)CC=C1 |
| InChI | InChI=1S/C16H20FNO2S/c1-3-4-5-6-7-13-21(19,20)18-14(2)15-9-8-10-16(17)12-11-15/h3-9,11-12,14,18H,1,10,13H2,2H3/b5-4-,7-6-/t14-/m1/s1 |
| InChIKey | ZFGWDDRSCWXGFZ-YOUBIVCXSA-N |
| XLogP | 3.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|