C11H16F3NO2S — CID 123537012
4-methyl-N-(1,1,1-trifluoropropan-2-yl)hepta-1,3,5-triene-3-sulfonamide (PubChem CID 123537012) has the molecular formula C11H16F3NO2S and a molecular weight of 283.32 g/mol. Its IUPAC name is 4-methyl-N-(1,1,1-trifluoropropan-2-yl)hepta-1,3,5-triene-3-sulfonamide.
| Compound Name | 4-methyl-N-(1,1,1-trifluoropropan-2-yl)hepta-1,3,5-triene-3-sulfonamide |
|---|---|
| PubChem CID | 123537012 |
| Molecular Formula | C11H16F3NO2S |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-methyl-N-(1,1,1-trifluoropropan-2-yl)hepta-1,3,5-triene-3-sulfonamide |
| SMILES | C=CC(=C(C)C=CC)S(=O)(=O)NC(C)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO2S/c1-5-7-8(3)10(6-2)18(16,17)15-9(4)11(12,13)14/h5-7,9,15H,2H2,1,3-4H3 |
| InChIKey | NBJUATBEUDMDKV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|