C14H18F3NOS — CID 143115978
1,1,1-trifluoro-N-[(6E,9Z)-7-methyl-8-methylideneundeca-1,3,6,9-tetraen-5-yl]methanesulfinamide (PubChem CID 143115978) has the molecular formula C14H18F3NOS and a molecular weight of 305.37 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[(6E,9Z)-7-methyl-8-methylideneundeca-1,3,6,9-tetraen-5-yl]methanesulfinamide.
| Compound Name | 1,1,1-trifluoro-N-[(6E,9Z)-7-methyl-8-methylideneundeca-1,3,6,9-tetraen-5-yl]methanesulfinamide |
|---|---|
| PubChem CID | 143115978 |
| Molecular Formula | C14H18F3NOS |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1,1,1-trifluoro-N-[(6E,9Z)-7-methyl-8-methylideneundeca-1,3,6,9-tetraen-5-yl]methanesulfinamide |
| SMILES | C=CC=CC(/C=C(\C)C(=C)/C=C\C)NS(=O)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NOS/c1-5-7-9-13(18-20(19)14(15,16)17)10-12(4)11(3)8-6-2/h5-10,13,18H,1,3H2,2,4H3/b8-6-,9-7?,12-10+ |
| InChIKey | RAHAJTZPOSIFDK-UZGIISGCSA-N |
| XLogP | 3.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|