C18H32F3NOS — CID 143346340
(3Z,6Z)-6,7-dimethyl-2-propylcycloocta-1,3,6-triene;ethane;N-ethyl-1,1,1-trifluoromethanesulfinamide (PubChem CID 143346340) has the molecular formula C18H32F3NOS and a molecular weight of 367.52 g/mol. Its IUPAC name is (3Z,6Z)-6,7-dimethyl-2-propylcycloocta-1,3,6-triene;ethane;N-ethyl-1,1,1-trifluoromethanesulfinamide.
| Compound Name | (3Z,6Z)-6,7-dimethyl-2-propylcycloocta-1,3,6-triene;ethane;N-ethyl-1,1,1-trifluoromethanesulfinamide |
|---|---|
| PubChem CID | 143346340 |
| Molecular Formula | C18H32F3NOS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | (3Z,6Z)-6,7-dimethyl-2-propylcycloocta-1,3,6-triene;ethane;N-ethyl-1,1,1-trifluoromethanesulfinamide |
| SMILES | CC.CCCC1=CC/C(C)=C(/C)C/C=C\1.CCNS(=O)C(F)(F)F |
| InChI | InChI=1S/C13H20.C3H6F3NOS.C2H6/c1-4-6-13-8-5-7-11(2)12(3)9-10-13;1-2-7-9(8)3(4,5)6;1-2/h5,8,10H,4,6-7,9H2,1-3H3;7H,2H2,1H3;1-2H3/b8-5-,12-11-,13-10?;; |
| InChIKey | FVONUWHTPRHIDL-JYSLVTJWSA-N |
| XLogP | 6.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|