C9H14F3N — CID 170619250
(Z)-1,1-difluoro-3-(1-fluoroethenyl)pent-3-en-2-amine;ethene (PubChem CID 170619250) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is (Z)-1,1-difluoro-3-(1-fluoroethenyl)pent-3-en-2-amine;ethene.
| Compound Name | (Z)-1,1-difluoro-3-(1-fluoroethenyl)pent-3-en-2-amine;ethene |
|---|---|
| PubChem CID | 170619250 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (Z)-1,1-difluoro-3-(1-fluoroethenyl)pent-3-en-2-amine;ethene |
| SMILES | C=C.C=C(F)/C(=C\C)C(N)C(F)F |
| InChI | InChI=1S/C7H10F3N.C2H4/c1-3-5(4(2)8)6(11)7(9)10;1-2/h3,6-7H,2,11H2,1H3;1-2H2/b5-3+; |
| InChIKey | MCWFDNGCYKQNMT-WGCWOXMQSA-N |
| XLogP | 2.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|