C12H20F3N — CID 142547622
ethane;(4E)-4-ethenyl-1,1,1-trifluoro-6-methylhepta-4,6-dien-3-amine (PubChem CID 142547622) has the molecular formula C12H20F3N and a molecular weight of 235.29 g/mol. Its IUPAC name is ethane;(4E)-4-ethenyl-1,1,1-trifluoro-6-methylhepta-4,6-dien-3-amine.
| Compound Name | ethane;(4E)-4-ethenyl-1,1,1-trifluoro-6-methylhepta-4,6-dien-3-amine |
|---|---|
| PubChem CID | 142547622 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | ethane;(4E)-4-ethenyl-1,1,1-trifluoro-6-methylhepta-4,6-dien-3-amine |
| SMILES | C=C/C(=C\C(=C)C)C(N)CC(F)(F)F.CC |
| InChI | InChI=1S/C10H14F3N.C2H6/c1-4-8(5-7(2)3)9(14)6-10(11,12)13;1-2/h4-5,9H,1-2,6,14H2,3H3;1-2H3/b8-5+; |
| InChIKey | SUFZVGYEQYILPC-HAAWTFQLSA-N |
| XLogP | 3.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|