C9H19FN2 — CID 88697808
(E)-1-fluoro-5-methyloct-4-ene-2,6-diamine (PubChem CID 88697808) has the molecular formula C9H19FN2 and a molecular weight of 174.26 g/mol. Its IUPAC name is (E)-1-fluoro-5-methyloct-4-ene-2,6-diamine.
| Compound Name | (E)-1-fluoro-5-methyloct-4-ene-2,6-diamine |
|---|---|
| PubChem CID | 88697808 |
| Molecular Formula | C9H19FN2 |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | (E)-1-fluoro-5-methyloct-4-ene-2,6-diamine |
| SMILES | CCC(N)/C(C)=C/CC(N)CF |
| InChI | InChI=1S/C9H19FN2/c1-3-9(12)7(2)4-5-8(11)6-10/h4,8-9H,3,5-6,11-12H2,1-2H3/b7-4+ |
| InChIKey | OWKYIRALNVQNED-QPJJXVBHSA-N |
| XLogP | 1.36 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|