C11H21N — CID 55254845
(3E)-4,8-dimethylnona-3,7-dien-1-amine (PubChem CID 55254845) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (3E)-4,8-dimethylnona-3,7-dien-1-amine.
| Compound Name | (3E)-4,8-dimethylnona-3,7-dien-1-amine |
|---|---|
| PubChem CID | 55254845 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (3E)-4,8-dimethylnona-3,7-dien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CCN |
| InChI | InChI=1S/C11H21N/c1-10(2)6-4-7-11(3)8-5-9-12/h6,8H,4-5,7,9,12H2,1-3H3/b11-8+ |
| InChIKey | UKUFQGQFQDXIHT-DHZHZOJOSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|