C11H17F2N — CID 143346404
(3Z)-4-(1,1-difluoroethyl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine (PubChem CID 143346404) has the molecular formula C11H17F2N and a molecular weight of 201.26 g/mol. Its IUPAC name is (3Z)-4-(1,1-difluoroethyl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine.
| Compound Name | (3Z)-4-(1,1-difluoroethyl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine |
|---|---|
| PubChem CID | 143346404 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | (3Z)-4-(1,1-difluoroethyl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine |
| SMILES | C=C/C(=C(\C=C/C)C(C)N)C(C)(F)F |
| InChI | InChI=1S/C11H17F2N/c1-5-7-9(8(3)14)10(6-2)11(4,12)13/h5-8H,2,14H2,1,3-4H3/b7-5-,10-9- |
| InChIKey | OIYRWQQEUAGUMC-XGOROQTFSA-N |
| XLogP | 3.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|