C8H16F2N2 — CID 88698900
(E)-7,7-difluoro-4-methylhept-3-ene-2,6-diamine (PubChem CID 88698900) has the molecular formula C8H16F2N2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (E)-7,7-difluoro-4-methylhept-3-ene-2,6-diamine.
| Compound Name | (E)-7,7-difluoro-4-methylhept-3-ene-2,6-diamine |
|---|---|
| PubChem CID | 88698900 |
| Molecular Formula | C8H16F2N2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | (E)-7,7-difluoro-4-methylhept-3-ene-2,6-diamine |
| SMILES | C/C(=C\C(C)N)CC(N)C(F)F |
| InChI | InChI=1S/C8H16F2N2/c1-5(3-6(2)11)4-7(12)8(9)10/h3,6-8H,4,11-12H2,1-2H3/b5-3+ |
| InChIKey | IERDHYBRFCDUEO-HWKANZROSA-N |
| XLogP | 1.26 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|