C10H15F2N — CID 155442202
(3Z,5E)-5-(1,1-difluoroethyl)octa-3,5,7-trien-2-amine (PubChem CID 155442202) has the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. Its IUPAC name is (3Z,5E)-5-(1,1-difluoroethyl)octa-3,5,7-trien-2-amine.
| Compound Name | (3Z,5E)-5-(1,1-difluoroethyl)octa-3,5,7-trien-2-amine |
|---|---|
| PubChem CID | 155442202 |
| Molecular Formula | C10H15F2N |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (3Z,5E)-5-(1,1-difluoroethyl)octa-3,5,7-trien-2-amine |
| SMILES | C=C/C=C(\C=C/C(C)N)C(C)(F)F |
| InChI | InChI=1S/C10H15F2N/c1-4-5-9(10(3,11)12)7-6-8(2)13/h4-8H,1,13H2,2-3H3/b7-6-,9-5+ |
| InChIKey | NEHICUXZLNLKFX-QRLJIZSYSA-N |
| XLogP | 2.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|