C15H29F2N — CID 143346403
(3Z)-4-(1,1-difluoroethyl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane (PubChem CID 143346403) has the molecular formula C15H29F2N and a molecular weight of 261.40 g/mol. Its IUPAC name is (3Z)-4-(1,1-difluoroethyl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane.
| Compound Name | (3Z)-4-(1,1-difluoroethyl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane |
|---|---|
| PubChem CID | 143346403 |
| Molecular Formula | C15H29F2N |
| Molecular Weight | 261.40 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | (3Z)-4-(1,1-difluoroethyl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane |
| SMILES | C=C/C(=C(\C=C/C)C(C)N)C(C)(F)F.CC.CC |
| InChI | InChI=1S/C11H17F2N.2C2H6/c1-5-7-9(8(3)14)10(6-2)11(4,12)13;2*1-2/h5-8H,2,14H2,1,3-4H3;2*1-2H3/b7-5-,10-9-;; |
| InChIKey | VCNCHQXWIMOJSZ-MJRICWHISA-N |
| XLogP | 5.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|