C8H12F3NO2S — CID 91254200
N-(1,1,1-trifluoropropan-2-yl)penta-1,3-diene-3-sulfonamide (PubChem CID 91254200) has the molecular formula C8H12F3NO2S and a molecular weight of 243.25 g/mol. Its IUPAC name is N-(1,1,1-trifluoropropan-2-yl)penta-1,3-diene-3-sulfonamide.
| Compound Name | N-(1,1,1-trifluoropropan-2-yl)penta-1,3-diene-3-sulfonamide |
|---|---|
| PubChem CID | 91254200 |
| Molecular Formula | C8H12F3NO2S |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-(1,1,1-trifluoropropan-2-yl)penta-1,3-diene-3-sulfonamide |
| SMILES | C=CC(=CC)S(=O)(=O)NC(C)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2S/c1-4-7(5-2)15(13,14)12-6(3)8(9,10)11/h4-6,12H,1H2,2-3H3 |
| InChIKey | IRHBQMGJUGEAKG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|