C10H17F2NO2S — CID 162588460
(2E)-N-(2,2-difluoropropyl)-5-methylhexa-2,4-diene-2-sulfonamide (PubChem CID 162588460) has the molecular formula C10H17F2NO2S and a molecular weight of 253.31 g/mol. Its IUPAC name is (2E)-N-(2,2-difluoropropyl)-5-methylhexa-2,4-diene-2-sulfonamide.
| Compound Name | (2E)-N-(2,2-difluoropropyl)-5-methylhexa-2,4-diene-2-sulfonamide |
|---|---|
| PubChem CID | 162588460 |
| Molecular Formula | C10H17F2NO2S |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (2E)-N-(2,2-difluoropropyl)-5-methylhexa-2,4-diene-2-sulfonamide |
| SMILES | CC(C)=C/C=C(\C)S(=O)(=O)NCC(C)(F)F |
| InChI | InChI=1S/C10H17F2NO2S/c1-8(2)5-6-9(3)16(14,15)13-7-10(4,11)12/h5-6,13H,7H2,1-4H3/b9-6+ |
| InChIKey | CCZMGOSPKPTQIT-RMKNXTFCSA-N |
| XLogP | 2.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|