C14H21F3N2O2S — CID 123788858
(2E,3Z)-3-methyl-1-methylimino-2-propylidene-N-(1,1,1-trifluoropropan-2-yl)hexa-3,5-diene-1-sulfonamide (PubChem CID 123788858) has the molecular formula C14H21F3N2O2S and a molecular weight of 338.40 g/mol. Its IUPAC name is (2E,3Z)-3-methyl-1-methylimino-2-propylidene-N-(1,1,1-trifluoropropan-2-yl)hexa-3,5-diene-1-sulfonamide.
| Compound Name | (2E,3Z)-3-methyl-1-methylimino-2-propylidene-N-(1,1,1-trifluoropropan-2-yl)hexa-3,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 123788858 |
| Molecular Formula | C14H21F3N2O2S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (2E,3Z)-3-methyl-1-methylimino-2-propylidene-N-(1,1,1-trifluoropropan-2-yl)hexa-3,5-diene-1-sulfonamide |
| SMILES | C=C/C=C(C)\C(=C/CC)C(=N/C)\S(=O)(=O)NC(C)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O2S/c1-6-8-10(3)12(9-7-2)13(18-5)22(20,21)19-11(4)14(15,16)17/h6,8-9,11,19H,1,7H2,2-5H3/b10-8-,12-9+,18-13+ |
| InChIKey | XCYGOLHTPNGEKE-JTQXFQARSA-N |
| XLogP | 3.35 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|