C11H20FNO2S — CID 143860161
N-[(3Z,5Z)-3-(fluoromethyl)octa-3,5-dienyl]ethanesulfonamide (PubChem CID 143860161) has the molecular formula C11H20FNO2S and a molecular weight of 249.35 g/mol. Its IUPAC name is N-[(3Z,5Z)-3-(fluoromethyl)octa-3,5-dienyl]ethanesulfonamide.
| Compound Name | N-[(3Z,5Z)-3-(fluoromethyl)octa-3,5-dienyl]ethanesulfonamide |
|---|---|
| PubChem CID | 143860161 |
| Molecular Formula | C11H20FNO2S |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N-[(3Z,5Z)-3-(fluoromethyl)octa-3,5-dienyl]ethanesulfonamide |
| SMILES | CC/C=C\C=C(/CF)CCNS(=O)(=O)CC |
| InChI | InChI=1S/C11H20FNO2S/c1-3-5-6-7-11(10-12)8-9-13-16(14,15)4-2/h5-7,13H,3-4,8-10H2,1-2H3/b6-5-,11-7- |
| InChIKey | WVAZBOMGWCYUGM-FUVGTJSASA-N |
| XLogP | 2.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|