C12H20F3NO2S — CID 123314763
2-methyl-2-[3-(trifluoromethyl)hepta-2,4-dienylsulfonyl]propan-1-amine (PubChem CID 123314763) has the molecular formula C12H20F3NO2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-methyl-2-[3-(trifluoromethyl)hepta-2,4-dienylsulfonyl]propan-1-amine.
| Compound Name | 2-methyl-2-[3-(trifluoromethyl)hepta-2,4-dienylsulfonyl]propan-1-amine |
|---|---|
| PubChem CID | 123314763 |
| Molecular Formula | C12H20F3NO2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-methyl-2-[3-(trifluoromethyl)hepta-2,4-dienylsulfonyl]propan-1-amine |
| SMILES | CCC=CC(=CCS(=O)(=O)C(C)(C)CN)C(F)(F)F |
| InChI | InChI=1S/C12H20F3NO2S/c1-4-5-6-10(12(13,14)15)7-8-19(17,18)11(2,3)9-16/h5-7H,4,8-9,16H2,1-3H3 |
| InChIKey | OQTHFVMOPIUGEA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|