C14H23NO2S — CID 90768156
6-butylsulfonyl-4-ethylideneocta-2,5,7-trien-1-amine (PubChem CID 90768156) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 6-butylsulfonyl-4-ethylideneocta-2,5,7-trien-1-amine.
| Compound Name | 6-butylsulfonyl-4-ethylideneocta-2,5,7-trien-1-amine |
|---|---|
| PubChem CID | 90768156 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 6-butylsulfonyl-4-ethylideneocta-2,5,7-trien-1-amine |
| SMILES | C=CC(=CC(C=CCN)=CC)S(=O)(=O)CCCC |
| InChI | InChI=1S/C14H23NO2S/c1-4-7-11-18(16,17)14(6-3)12-13(5-2)9-8-10-15/h5-6,8-9,12H,3-4,7,10-11,15H2,1-2H3 |
| InChIKey | CNYNWAYVIAEBCC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|