C9H16N2O2S — CID 67248108
1-ethyl-4-methylsulfonylcyclohexa-3,5-diene-1,2-diamine (PubChem CID 67248108) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 1-ethyl-4-methylsulfonylcyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 1-ethyl-4-methylsulfonylcyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 67248108 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-ethyl-4-methylsulfonylcyclohexa-3,5-diene-1,2-diamine |
| SMILES | CCC1(N)C=CC(S(C)(=O)=O)=CC1N |
| InChI | InChI=1S/C9H16N2O2S/c1-3-9(11)5-4-7(6-8(9)10)14(2,12)13/h4-6,8H,3,10-11H2,1-2H3 |
| InChIKey | YNFKTVDLYWZRKA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |