C15H24FNOS — CID 143418320
(Z,4Z)-4-ethylidene-1-fluoro-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)oct-5-en-2-amine (PubChem CID 143418320) has the molecular formula C15H24FNOS and a molecular weight of 285.43 g/mol. Its IUPAC name is (Z,4Z)-4-ethylidene-1-fluoro-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)oct-5-en-2-amine.
| Compound Name | (Z,4Z)-4-ethylidene-1-fluoro-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)oct-5-en-2-amine |
|---|---|
| PubChem CID | 143418320 |
| Molecular Formula | C15H24FNOS |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (Z,4Z)-4-ethylidene-1-fluoro-7-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)oct-5-en-2-amine |
| SMILES | C/C=C(\C=C/C(C)C1=CCS(=O)CC1)CC(N)CF |
| InChI | InChI=1S/C15H24FNOS/c1-3-13(10-15(17)11-16)5-4-12(2)14-6-8-19(18)9-7-14/h3-6,12,15H,7-11,17H2,1-2H3/b5-4-,13-3+ |
| InChIKey | USWYOQAAVFGVTP-BNXXKACXSA-N |
| XLogP | 2.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|